C9H12N4O5S — CID 107829369
(2R)-5-methoxy-5-oxo-2-(thiadiazol-5-ylcarbamoylamino)pentanoic acid (PubChem CID 107829369) has the molecular formula C9H12N4O5S and a molecular weight of 288.29 g/mol. Its IUPAC name is (2R)-5-methoxy-5-oxo-2-(thiadiazol-5-ylcarbamoylamino)pentanoic acid.
| Compound Name | (2R)-5-methoxy-5-oxo-2-(thiadiazol-5-ylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 107829369 |
| Molecular Formula | C9H12N4O5S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (2R)-5-methoxy-5-oxo-2-(thiadiazol-5-ylcarbamoylamino)pentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)Nc1cnns1)C(=O)O |
| InChI | InChI=1S/C9H12N4O5S/c1-18-7(14)3-2-5(8(15)16)11-9(17)12-6-4-10-13-19-6/h4-5H,2-3H2,1H3,(H,15,16)(H2,11,12,17)/t5-/m1/s1 |
| InChIKey | YBXKUMPIBSCLAX-RXMQYKEDSA-N |
| XLogP | 0.07 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |