C9H14N4O3S — CID 114913159
3-(thiadiazol-5-ylcarbamoylamino)hexanoic acid (PubChem CID 114913159) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-(thiadiazol-5-ylcarbamoylamino)hexanoic acid.
| Compound Name | 3-(thiadiazol-5-ylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 114913159 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-(thiadiazol-5-ylcarbamoylamino)hexanoic acid |
| SMILES | CCCC(CC(=O)O)NC(=O)Nc1cnns1 |
| InChI | InChI=1S/C9H14N4O3S/c1-2-3-6(4-8(14)15)11-9(16)12-7-5-10-13-17-7/h5-6H,2-4H2,1H3,(H,14,15)(H2,11,12,16) |
| InChIKey | GAZOHUVGZWVZER-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |