C13H15IN2O5 — CID 107825786
(2R)-2-[(2-iodophenyl)carbamoylamino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107825786) has the molecular formula C13H15IN2O5 and a molecular weight of 406.18 g/mol. Its IUPAC name is (2R)-2-[(2-iodophenyl)carbamoylamino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[(2-iodophenyl)carbamoylamino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107825786 |
| Molecular Formula | C13H15IN2O5 |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | (2R)-2-[(2-iodophenyl)carbamoylamino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)Nc1ccccc1I)C(=O)O |
| InChI | InChI=1S/C13H15IN2O5/c1-21-11(17)7-6-10(12(18)19)16-13(20)15-9-5-3-2-4-8(9)14/h2-5,10H,6-7H2,1H3,(H,18,19)(H2,15,16,20)/t10-/m1/s1 |
| InChIKey | KLTVHGWGOJWIEC-SNVBAGLBSA-N |
| XLogP | 1.82 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|