C11H12IN3O4 — CID 63714892
(2S)-4-amino-2-[(2-iodophenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 63714892) has the molecular formula C11H12IN3O4 and a molecular weight of 377.14 g/mol. Its IUPAC name is (2S)-4-amino-2-[(2-iodophenyl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(2-iodophenyl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63714892 |
| Molecular Formula | C11H12IN3O4 |
| Molecular Weight | 377.14 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | (2S)-4-amino-2-[(2-iodophenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)Nc1ccccc1I)C(=O)O |
| InChI | InChI=1S/C11H12IN3O4/c12-6-3-1-2-4-7(6)14-11(19)15-8(10(17)18)5-9(13)16/h1-4,8H,5H2,(H2,13,16)(H,17,18)(H2,14,15,19)/t8-/m0/s1 |
| InChIKey | CVRLNXGHPOQGBT-QMMMGPOBSA-N |
| XLogP | 0.74 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|