C10H17N5O3S — CID 114913502
5,5-dimethyl-3-(thiatriazol-5-ylcarbamoylamino)hexanoic acid (PubChem CID 114913502) has the molecular formula C10H17N5O3S and a molecular weight of 287.35 g/mol. Its IUPAC name is 5,5-dimethyl-3-(thiatriazol-5-ylcarbamoylamino)hexanoic acid.
| Compound Name | 5,5-dimethyl-3-(thiatriazol-5-ylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 114913502 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5,5-dimethyl-3-(thiatriazol-5-ylcarbamoylamino)hexanoic acid |
| SMILES | CC(C)(C)CC(CC(=O)O)NC(=O)Nc1nnns1 |
| InChI | InChI=1S/C10H17N5O3S/c1-10(2,3)5-6(4-7(16)17)11-8(18)12-9-13-14-15-19-9/h6H,4-5H2,1-3H3,(H,16,17)(H2,11,12,13,15,18) |
| InChIKey | MBEQHKTZYGUNFL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |