C6H7N5O5S — CID 104983028
(2R)-2-(thiatriazol-5-ylcarbamoylamino)butanedioic acid (PubChem CID 104983028) has the molecular formula C6H7N5O5S and a molecular weight of 261.22 g/mol. Its IUPAC name is (2R)-2-(thiatriazol-5-ylcarbamoylamino)butanedioic acid.
| Compound Name | (2R)-2-(thiatriazol-5-ylcarbamoylamino)butanedioic acid |
|---|---|
| PubChem CID | 104983028 |
| Molecular Formula | C6H7N5O5S |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | (2R)-2-(thiatriazol-5-ylcarbamoylamino)butanedioic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)Nc1nnns1)C(=O)O |
| InChI | InChI=1S/C6H7N5O5S/c12-3(13)1-2(4(14)15)7-5(16)8-6-9-10-11-17-6/h2H,1H2,(H,12,13)(H,14,15)(H2,7,8,9,11,16)/t2-/m1/s1 |
| InChIKey | IEMKAGHAESYVMW-UWTATZPHSA-N |
| XLogP | -1.02 |
| TPSA | 154.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |