C7H11N5O3S — CID 114913370
3-[ethyl(thiatriazol-5-ylcarbamoyl)amino]propanoic acid (PubChem CID 114913370) has the molecular formula C7H11N5O3S and a molecular weight of 245.26 g/mol. Its IUPAC name is 3-[ethyl(thiatriazol-5-ylcarbamoyl)amino]propanoic acid.
| Compound Name | 3-[ethyl(thiatriazol-5-ylcarbamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 114913370 |
| Molecular Formula | C7H11N5O3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-[ethyl(thiatriazol-5-ylcarbamoyl)amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)Nc1nnns1 |
| InChI | InChI=1S/C7H11N5O3S/c1-2-12(4-3-5(13)14)7(15)8-6-9-10-11-16-6/h2-4H2,1H3,(H,13,14)(H,8,9,11,15) |
| InChIKey | HTBRLLMHTFEMQW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |