C6H11N5OS — CID 107570824
(2R)-2-amino-N-(thiatriazol-5-yl)pentanamide (PubChem CID 107570824) has the molecular formula C6H11N5OS and a molecular weight of 201.25 g/mol. Its IUPAC name is (2R)-2-amino-N-(thiatriazol-5-yl)pentanamide.
| Compound Name | (2R)-2-amino-N-(thiatriazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 107570824 |
| Molecular Formula | C6H11N5OS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | (2R)-2-amino-N-(thiatriazol-5-yl)pentanamide |
| SMILES | CCC[C@@H](N)C(=O)Nc1nnns1 |
| InChI | InChI=1S/C6H11N5OS/c1-2-3-4(7)5(12)8-6-9-10-11-13-6/h4H,2-3,7H2,1H3,(H,8,9,11,12)/t4-/m1/s1 |
| InChIKey | NDGZYNCRUUSARX-SCSAIBSYSA-N |
| XLogP | -0.00 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |