C5H9N5OS — CID 104982974
(2R)-2-amino-N-(thiatriazol-5-yl)butanamide (PubChem CID 104982974) has the molecular formula C5H9N5OS and a molecular weight of 187.23 g/mol. Its IUPAC name is (2R)-2-amino-N-(thiatriazol-5-yl)butanamide.
| Compound Name | (2R)-2-amino-N-(thiatriazol-5-yl)butanamide |
|---|---|
| PubChem CID | 104982974 |
| Molecular Formula | C5H9N5OS |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | (2R)-2-amino-N-(thiatriazol-5-yl)butanamide |
| SMILES | CC[C@@H](N)C(=O)Nc1nnns1 |
| InChI | InChI=1S/C5H9N5OS/c1-2-3(6)4(11)7-5-8-9-10-12-5/h3H,2,6H2,1H3,(H,7,8,10,11)/t3-/m1/s1 |
| InChIKey | LTKJTCCIPAZKPQ-GSVOUGTGSA-N |
| XLogP | -0.39 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |