C9H14ClN3O2S — CID 119329727
(2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride (PubChem CID 119329727) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride.
| Compound Name | (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride |
|---|---|
| PubChem CID | 119329727 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride |
| SMILES | CC[C@H](N)C(=O)Nc1ncc(C(C)=O)s1.Cl |
| InChI | InChI=1S/C9H13N3O2S.ClH/c1-3-6(10)8(14)12-9-11-4-7(15-9)5(2)13;/h4,6H,3,10H2,1-2H3,(H,11,12,14);1H/t6-;/m0./s1 |
| InChIKey | ZKWGVUCWXUMTCL-RGMNGODLSA-N |
| XLogP | 1.44 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |