About (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride
(2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride (PubChem CID 119329727) has the molecular formula C9H14ClN3O2S
and a molecular weight of 263.75 g/mol. Its IUPAC name is (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride.
Molecular Properties
| Compound Name | (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride |
| PubChem CID | 119329727 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride |
| SMILES | CC[C@H](N)C(=O)Nc1ncc(C(C)=O)s1.Cl |
| InChI | InChI=1S/C9H13N3O2S.ClH/c1-3-6(10)8(14)12-9-11-4-7(15-9)5(2)13;/h4,6H,3,10H2,1-2H3,(H,11,12,14);1H/t6-;/m0./s1 |
| InChIKey | ZKWGVUCWXUMTCL-RGMNGODLSA-N |
| XLogP | 1.44 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride?
The IUPAC name of (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride (CID 119329727) is (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride.
What is the SMILES notation for (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride?
The canonical SMILES for (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride is CC[C@H](N)C(=O)Nc1ncc(C(C)=O)s1.Cl.
What is the InChIKey of (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride?
The InChIKey is ZKWGVUCWXUMTCL-RGMNGODLSA-N. The full InChI is InChI=1S/C9H13N3O2S.ClH/c1-3-6(10)8(14)12-9-11-4-7(15-9)5(2)13;/h4,6H,3,10H2,1-2H3,(H,11,12,14);1H/t6-;/m0./s1.
What are the key properties of (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride?
(2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride has a molecular weight of 263.75 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(5-acetyl-1,3-thiazol-2-yl)-2-aminobutanamide;hydrochloride is sourced from PubChem (CID 119329727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).