C9H15N3OS — CID 61467509
2-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide (PubChem CID 61467509) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 2-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 61467509 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide |
| SMILES | CCC(N)C(=O)Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C9H15N3OS/c1-4-7(10)8(13)12-9-11-5(2)6(3)14-9/h7H,4,10H2,1-3H3,(H,11,12,13) |
| InChIKey | ITSDIVPDIMXPSU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |