C10H15BrN2OS — CID 43470560
2-bromo-N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methylbutanamide (PubChem CID 43470560) has the molecular formula C10H15BrN2OS and a molecular weight of 291.21 g/mol. Its IUPAC name is 2-bromo-N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methylbutanamide.
| Compound Name | 2-bromo-N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 43470560 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-bromo-N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methylbutanamide |
| SMILES | Cc1nc(NC(=O)C(Br)C(C)C)sc1C |
| InChI | InChI=1S/C10H15BrN2OS/c1-5(2)8(11)9(14)13-10-12-6(3)7(4)15-10/h5,8H,1-4H3,(H,12,13,14) |
| InChIKey | VEFAUPSVRLQSAD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|