About 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide
2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide (PubChem CID 112811581) has the molecular formula C16H20BrN3OS
and a molecular weight of 382.33 g/mol. Its IUPAC name is 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide.
Molecular Properties
| Compound Name | 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide |
| PubChem CID | 112811581 |
| Molecular Formula | C16H20BrN3OS |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1nc(NC(=O)C(C)NC(C)c2ccccc2Br)sc1C |
| InChI | InChI=1S/C16H20BrN3OS/c1-9-12(4)22-16(19-9)20-15(21)11(3)18-10(2)13-7-5-6-8-14(13)17/h5-8,10-11,18H,1-4H3,(H,19,20,21) |
| InChIKey | SEWMIBWWAPZOGG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide?
The IUPAC name of 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide (CID 112811581) is 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide.
What is the SMILES notation for 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide?
The canonical SMILES for 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide is Cc1nc(NC(=O)C(C)NC(C)c2ccccc2Br)sc1C.
What is the InChIKey of 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide?
The InChIKey is SEWMIBWWAPZOGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20BrN3OS/c1-9-12(4)22-16(19-9)20-15(21)11(3)18-10(2)13-7-5-6-8-14(13)17/h5-8,10-11,18H,1-4H3,(H,19,20,21).
What are the key properties of 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide?
2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide has a molecular weight of 382.33 g/mol, XLogP of 4.20, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-bromophenyl)ethylamino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide is sourced from PubChem (CID 112811581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).