C8H10N4OS — CID 108864824
1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea (PubChem CID 108864824) has the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. Its IUPAC name is 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 108864824 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1nc(NC(=O)NCC#N)sc1C |
| InChI | InChI=1S/C8H10N4OS/c1-5-6(2)14-8(11-5)12-7(13)10-4-3-9/h4H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | XNPBFOBYINVUPO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|