About 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea
1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea (PubChem CID 108864824) has the molecular formula C8H10N4OS
and a molecular weight of 210.26 g/mol. Its IUPAC name is 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 108864824 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1nc(NC(=O)NCC#N)sc1C |
| InChI | InChI=1S/C8H10N4OS/c1-5-6(2)14-8(11-5)12-7(13)10-4-3-9/h4H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | XNPBFOBYINVUPO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea (CID 108864824) is 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea is Cc1nc(NC(=O)NCC#N)sc1C.
What is the InChIKey of 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea?
The InChIKey is XNPBFOBYINVUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS/c1-5-6(2)14-8(11-5)12-7(13)10-4-3-9/h4H2,1-2H3,(H2,10,11,12,13).
What are the key properties of 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea?
1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea has a molecular weight of 210.26 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyanomethyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 108864824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).