C7H12N4OS — CID 115976440
2-amino-N-(3-methyl-1,2,4-thiadiazol-5-yl)butanamide (PubChem CID 115976440) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-amino-N-(3-methyl-1,2,4-thiadiazol-5-yl)butanamide.
| Compound Name | 2-amino-N-(3-methyl-1,2,4-thiadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 115976440 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-amino-N-(3-methyl-1,2,4-thiadiazol-5-yl)butanamide |
| SMILES | CCC(N)C(=O)Nc1nc(C)ns1 |
| InChI | InChI=1S/C7H12N4OS/c1-3-5(8)6(12)10-7-9-4(2)11-13-7/h5H,3,8H2,1-2H3,(H,9,10,11,12) |
| InChIKey | NBTDGDIYQMDYFT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |