C6H9N3OS2 — CID 107035956
N-(3-methyl-1,2,4-thiadiazol-5-yl)-3-sulfanylpropanamide (PubChem CID 107035956) has the molecular formula C6H9N3OS2 and a molecular weight of 203.29 g/mol. Its IUPAC name is N-(3-methyl-1,2,4-thiadiazol-5-yl)-3-sulfanylpropanamide.
| Compound Name | N-(3-methyl-1,2,4-thiadiazol-5-yl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107035956 |
| Molecular Formula | C6H9N3OS2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | N-(3-methyl-1,2,4-thiadiazol-5-yl)-3-sulfanylpropanamide |
| SMILES | Cc1nsc(NC(=O)CCS)n1 |
| InChI | InChI=1S/C6H9N3OS2/c1-4-7-6(12-9-4)8-5(10)2-3-11/h11H,2-3H2,1H3,(H,7,8,9,10) |
| InChIKey | AOUJTMXURUSQPG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|