C6H6Cl3N3O2S — CID 86625501
2,2,2-trichloroethyl N-(3-methyl-1,2,4-thiadiazol-5-yl)carbamate (PubChem CID 86625501) has the molecular formula C6H6Cl3N3O2S and a molecular weight of 290.56 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(3-methyl-1,2,4-thiadiazol-5-yl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(3-methyl-1,2,4-thiadiazol-5-yl)carbamate |
|---|---|
| PubChem CID | 86625501 |
| Molecular Formula | C6H6Cl3N3O2S |
| Molecular Weight | 290.56 g/mol |
| Exact Mass | 288.92 |
| IUPAC Name | 2,2,2-trichloroethyl N-(3-methyl-1,2,4-thiadiazol-5-yl)carbamate |
| SMILES | Cc1nsc(NC(=O)OCC(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C6H6Cl3N3O2S/c1-3-10-4(15-12-3)11-5(13)14-2-6(7,8)9/h2H2,1H3,(H,10,11,12,13) |
| InChIKey | UGTCUGUGWFMAJE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|