C8H8Cl3N3O4S — CID 22819001
(2S)-2-amino-2-[2-(2,2,2-trichloroethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 22819001) has the molecular formula C8H8Cl3N3O4S and a molecular weight of 348.60 g/mol. Its IUPAC name is (2S)-2-amino-2-[2-(2,2,2-trichloroethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2S)-2-amino-2-[2-(2,2,2-trichloroethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 22819001 |
| Molecular Formula | C8H8Cl3N3O4S |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | (2S)-2-amino-2-[2-(2,2,2-trichloroethoxycarbonylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | N[C@H](C(=O)O)c1csc(NC(=O)OCC(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C8H8Cl3N3O4S/c9-8(10,11)2-18-7(17)14-6-13-3(1-19-6)4(12)5(15)16/h1,4H,2,12H2,(H,15,16)(H,13,14,17)/t4-/m0/s1 |
| InChIKey | MMGKWEFIKCIMIU-BYPYZUCNSA-N |
| XLogP | 2.15 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|