C7H7Cl3N2O3 — CID 86245081
2,2,2-trichloroethyl N-(5-methyl-1,2-oxazol-3-yl)carbamate (PubChem CID 86245081) has the molecular formula C7H7Cl3N2O3 and a molecular weight of 273.50 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(5-methyl-1,2-oxazol-3-yl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(5-methyl-1,2-oxazol-3-yl)carbamate |
|---|---|
| PubChem CID | 86245081 |
| Molecular Formula | C7H7Cl3N2O3 |
| Molecular Weight | 273.50 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | 2,2,2-trichloroethyl N-(5-methyl-1,2-oxazol-3-yl)carbamate |
| SMILES | Cc1cc(NC(=O)OCC(Cl)(Cl)Cl)no1 |
| InChI | InChI=1S/C7H7Cl3N2O3/c1-4-2-5(12-15-4)11-6(13)14-3-7(8,9)10/h2H,3H2,1H3,(H,11,12,13) |
| InChIKey | KUDJDIJQVQCOMJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|