C5H7N3OS — CID 2771005
(5-methyl-1,2-oxazol-3-yl)thiourea (PubChem CID 2771005) has the molecular formula C5H7N3OS and a molecular weight of 157.20 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)thiourea.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)thiourea |
|---|---|
| PubChem CID | 2771005 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)thiourea |
| SMILES | Cc1cc(NC(N)=S)no1 |
| InChI | InChI=1S/C5H7N3OS/c1-3-2-4(8-9-3)7-5(6)10/h2H,1H3,(H3,6,7,8,10) |
| InChIKey | WOIJLCXJXDRMJX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|