C4H6N2O2 — CID 172819404
N-(5-methyl-1,2-oxazol-3-yl)hydroxylamine (PubChem CID 172819404) has the molecular formula C4H6N2O2 and a molecular weight of 114.10 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)hydroxylamine.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)hydroxylamine |
|---|---|
| PubChem CID | 172819404 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)hydroxylamine |
| SMILES | Cc1cc(NO)no1 |
| InChI | InChI=1S/C4H6N2O2/c1-3-2-4(5-7)6-8-3/h2,7H,1H3,(H,5,6) |
| InChIKey | UADNBPACIOMTDO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|