C8H14N2O — CID 59569080
5-methyl-N-(2-methylpropyl)-1,2-oxazol-3-amine (PubChem CID 59569080) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 5-methyl-N-(2-methylpropyl)-1,2-oxazol-3-amine.
| Compound Name | 5-methyl-N-(2-methylpropyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 59569080 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 5-methyl-N-(2-methylpropyl)-1,2-oxazol-3-amine |
| SMILES | Cc1cc(NCC(C)C)no1 |
| InChI | InChI=1S/C8H14N2O/c1-6(2)5-9-8-4-7(3)11-10-8/h4,6H,5H2,1-3H3,(H,9,10) |
| InChIKey | BYSZJIMHSSAOPU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |