C14H23N3O3 — CID 47263951
N-(5-methyl-1,2-oxazol-3-yl)-N',N'-bis(2-methylpropyl)oxamide (PubChem CID 47263951) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-N',N'-bis(2-methylpropyl)oxamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-N',N'-bis(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 47263951 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-N',N'-bis(2-methylpropyl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)N(CC(C)C)CC(C)C)no1 |
| InChI | InChI=1S/C14H23N3O3/c1-9(2)7-17(8-10(3)4)14(19)13(18)15-12-6-11(5)20-16-12/h6,9-10H,7-8H2,1-5H3,(H,15,16,18) |
| InChIKey | AKICKBCIKIFFTM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|