C14H22ClN3O3 — CID 4167041
2-chloro-N-(3-methylbutyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]propanamide (PubChem CID 4167041) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is 2-chloro-N-(3-methylbutyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]propanamide.
| Compound Name | 2-chloro-N-(3-methylbutyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 4167041 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-chloro-N-(3-methylbutyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]propanamide |
| SMILES | Cc1cc(NC(=O)CN(CCC(C)C)C(=O)C(C)Cl)no1 |
| InChI | InChI=1S/C14H22ClN3O3/c1-9(2)5-6-18(14(20)11(4)15)8-13(19)16-12-7-10(3)21-17-12/h7,9,11H,5-6,8H2,1-4H3,(H,16,17,19) |
| InChIKey | YYGYSOBQJUSCDE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|