C18H23N5O5 — CID 3338382
2-[3-methylbutyl-[(4-nitrophenyl)carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 3338382) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-[3-methylbutyl-[(4-nitrophenyl)carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[3-methylbutyl-[(4-nitrophenyl)carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 3338382 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[3-methylbutyl-[(4-nitrophenyl)carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CN(CCC(C)C)C(=O)Nc2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C18H23N5O5/c1-12(2)8-9-22(11-17(24)20-16-10-13(3)28-21-16)18(25)19-14-4-6-15(7-5-14)23(26)27/h4-7,10,12H,8-9,11H2,1-3H3,(H,19,25)(H,20,21,24) |
| InChIKey | HDFSGRASOGXKJE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|