C17H21ClN4O6S — CID 5141625
2-[(4-chloro-3-nitrophenyl)sulfonyl-(3-methylbutyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 5141625) has the molecular formula C17H21ClN4O6S and a molecular weight of 444.90 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)sulfonyl-(3-methylbutyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-(3-methylbutyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 5141625 |
| Molecular Formula | C17H21ClN4O6S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-(3-methylbutyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CN(CCC(C)C)S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C17H21ClN4O6S/c1-11(2)6-7-21(10-17(23)19-16-8-12(3)28-20-16)29(26,27)13-4-5-14(18)15(9-13)22(24)25/h4-5,8-9,11H,6-7,10H2,1-3H3,(H,19,20,23) |
| InChIKey | SAMHTHZQDMTYJD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 135.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|