C19H26N6O5 — CID 42770460
2-[2-(diethylamino)ethyl-[(4-nitrophenyl)carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 42770460) has the molecular formula C19H26N6O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl-[(4-nitrophenyl)carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[2-(diethylamino)ethyl-[(4-nitrophenyl)carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 42770460 |
| Molecular Formula | C19H26N6O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[2-(diethylamino)ethyl-[(4-nitrophenyl)carbamoyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCN(CC)CCN(CC(=O)Nc1cc(C)on1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H26N6O5/c1-4-23(5-2)10-11-24(13-18(26)21-17-12-14(3)30-22-17)19(27)20-15-6-8-16(9-7-15)25(28)29/h6-9,12H,4-5,10-11,13H2,1-3H3,(H,20,27)(H,21,22,26) |
| InChIKey | JWQBOHHVNCWTKB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|