C18H23N5O5 — CID 42770327
N-[2-(dimethylamino)ethyl]-4-methyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 42770327) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-methyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-methyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 42770327 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-methyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | Cc1cc(NC(=O)CN(CCN(C)C)C(=O)c2ccc(C)c([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C18H23N5O5/c1-12-5-6-14(10-15(12)23(26)27)18(25)22(8-7-21(3)4)11-17(24)19-16-9-13(2)28-20-16/h5-6,9-10H,7-8,11H2,1-4H3,(H,19,20,24) |
| InChIKey | ZRQFUWMALJSUSA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 121.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|