C17H20N4O6 — CID 4054596
N-(3-methoxypropyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 4054596) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-(3-methoxypropyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4054596 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-(3-methoxypropyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | COCCCN(CC(=O)Nc1cc(C)on1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H20N4O6/c1-12-9-15(19-27-12)18-16(22)11-20(7-4-8-26-2)17(23)13-5-3-6-14(10-13)21(24)25/h3,5-6,9-10H,4,7-8,11H2,1-2H3,(H,18,19,22) |
| InChIKey | JLAQVVWESZEPIF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 127.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|