C18H23N3O5 — CID 4147660
2-methoxy-N-(3-methoxypropyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]benzamide (PubChem CID 4147660) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-methoxy-N-(3-methoxypropyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 2-methoxy-N-(3-methoxypropyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4147660 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-methoxy-N-(3-methoxypropyl)-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]benzamide |
| SMILES | COCCCN(CC(=O)Nc1cc(C)on1)C(=O)c1ccccc1OC |
| InChI | InChI=1S/C18H23N3O5/c1-13-11-16(20-26-13)19-17(22)12-21(9-6-10-24-2)18(23)14-7-4-5-8-15(14)25-3/h4-5,7-8,11H,6,9-10,12H2,1-3H3,(H,19,20,22) |
| InChIKey | UNDJVCZMRGCCPL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|