C11H12N2O — CID 122548872
5-methyl-N-(4-methylphenyl)-1,2-oxazol-3-amine (PubChem CID 122548872) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-methyl-N-(4-methylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-methyl-N-(4-methylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 122548872 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 5-methyl-N-(4-methylphenyl)-1,2-oxazol-3-amine |
| SMILES | Cc1ccc(Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C11H12N2O/c1-8-3-5-10(6-4-8)12-11-7-9(2)14-13-11/h3-7H,1-2H3,(H,12,13) |
| InChIKey | WGNDSAMFTUUNPN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |