C13H15N3O3 — CID 112990393
ethyl N-[4-[(5-methyl-1,2-oxazol-3-yl)amino]phenyl]carbamate (PubChem CID 112990393) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl N-[4-[(5-methyl-1,2-oxazol-3-yl)amino]phenyl]carbamate.
| Compound Name | ethyl N-[4-[(5-methyl-1,2-oxazol-3-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 112990393 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | ethyl N-[4-[(5-methyl-1,2-oxazol-3-yl)amino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C13H15N3O3/c1-3-18-13(17)15-11-6-4-10(5-7-11)14-12-8-9(2)19-16-12/h4-8H,3H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | GSUYWMNLASWXGA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |