C9H14N4OS — CID 104700593
1-cyclopentyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea (PubChem CID 104700593) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-cyclopentyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea.
| Compound Name | 1-cyclopentyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 104700593 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-cyclopentyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)urea |
| SMILES | Cc1nsc(NC(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C9H14N4OS/c1-6-10-9(15-13-6)12-8(14)11-7-4-2-3-5-7/h7H,2-5H2,1H3,(H2,10,11,12,13,14) |
| InChIKey | CLKUMRUBZRKHKL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |