C5H7N5OS2 — CID 114912683
3-amino-2-methyl-3-sulfanylidene-N-(thiatriazol-5-yl)propanamide (PubChem CID 114912683) has the molecular formula C5H7N5OS2 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-amino-2-methyl-3-sulfanylidene-N-(thiatriazol-5-yl)propanamide.
| Compound Name | 3-amino-2-methyl-3-sulfanylidene-N-(thiatriazol-5-yl)propanamide |
|---|---|
| PubChem CID | 114912683 |
| Molecular Formula | C5H7N5OS2 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 3-amino-2-methyl-3-sulfanylidene-N-(thiatriazol-5-yl)propanamide |
| SMILES | CC(C(=O)Nc1nnns1)C(N)=S |
| InChI | InChI=1S/C5H7N5OS2/c1-2(3(6)12)4(11)7-5-8-9-10-13-5/h2H,1H3,(H2,6,12)(H,7,8,10,11) |
| InChIKey | SZPKQGNWQDQCAZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|