C8H15N5OS — CID 114912385
4-(propan-2-ylamino)-N-(thiatriazol-5-yl)butanamide (PubChem CID 114912385) has the molecular formula C8H15N5OS and a molecular weight of 229.31 g/mol. Its IUPAC name is 4-(propan-2-ylamino)-N-(thiatriazol-5-yl)butanamide.
| Compound Name | 4-(propan-2-ylamino)-N-(thiatriazol-5-yl)butanamide |
|---|---|
| PubChem CID | 114912385 |
| Molecular Formula | C8H15N5OS |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 4-(propan-2-ylamino)-N-(thiatriazol-5-yl)butanamide |
| SMILES | CC(C)NCCCC(=O)Nc1nnns1 |
| InChI | InChI=1S/C8H15N5OS/c1-6(2)9-5-3-4-7(14)10-8-11-12-13-15-8/h6,9H,3-5H2,1-2H3,(H,10,11,13,14) |
| InChIKey | YVQCKVDTBGERBN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|