C12H22N4O — CID 114253600
N-(1,5-dimethylpyrazol-3-yl)-4-(propan-2-ylamino)butanamide (PubChem CID 114253600) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-3-yl)-4-(propan-2-ylamino)butanamide.
| Compound Name | N-(1,5-dimethylpyrazol-3-yl)-4-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 114253600 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | N-(1,5-dimethylpyrazol-3-yl)-4-(propan-2-ylamino)butanamide |
| SMILES | Cc1cc(NC(=O)CCCNC(C)C)nn1C |
| InChI | InChI=1S/C12H22N4O/c1-9(2)13-7-5-6-12(17)14-11-8-10(3)16(4)15-11/h8-9,13H,5-7H2,1-4H3,(H,14,15,17) |
| InChIKey | XGBOMBQLOQMAER-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|