C9H15N3O2 — CID 35761217
N-(1,5-dimethylpyrazol-3-yl)-3-methoxypropanamide (PubChem CID 35761217) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-3-yl)-3-methoxypropanamide.
| Compound Name | N-(1,5-dimethylpyrazol-3-yl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 35761217 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-(1,5-dimethylpyrazol-3-yl)-3-methoxypropanamide |
| SMILES | COCCC(=O)Nc1cc(C)n(C)n1 |
| InChI | InChI=1S/C9H15N3O2/c1-7-6-8(11-12(7)2)10-9(13)4-5-14-3/h6H,4-5H2,1-3H3,(H,10,11,13) |
| InChIKey | NWMLKPKVJHVOIP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |