C7H9N5OS — CID 114388038
3-amino-2-methyl-3-sulfanylidene-N-(1,2,4-triazin-3-yl)propanamide (PubChem CID 114388038) has the molecular formula C7H9N5OS and a molecular weight of 211.25 g/mol. Its IUPAC name is 3-amino-2-methyl-3-sulfanylidene-N-(1,2,4-triazin-3-yl)propanamide.
| Compound Name | 3-amino-2-methyl-3-sulfanylidene-N-(1,2,4-triazin-3-yl)propanamide |
|---|---|
| PubChem CID | 114388038 |
| Molecular Formula | C7H9N5OS |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 3-amino-2-methyl-3-sulfanylidene-N-(1,2,4-triazin-3-yl)propanamide |
| SMILES | CC(C(=O)Nc1nccnn1)C(N)=S |
| InChI | InChI=1S/C7H9N5OS/c1-4(5(8)14)6(13)11-7-9-2-3-10-12-7/h2-4H,1H3,(H2,8,14)(H,9,11,12,13) |
| InChIKey | CAZQQDGXDYSSCX-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|