C7H11N5O — CID 104919513
(2R)-2-amino-N-(1,2,4-triazin-3-yl)butanamide (PubChem CID 104919513) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is (2R)-2-amino-N-(1,2,4-triazin-3-yl)butanamide.
| Compound Name | (2R)-2-amino-N-(1,2,4-triazin-3-yl)butanamide |
|---|---|
| PubChem CID | 104919513 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | (2R)-2-amino-N-(1,2,4-triazin-3-yl)butanamide |
| SMILES | CC[C@@H](N)C(=O)Nc1nccnn1 |
| InChI | InChI=1S/C7H11N5O/c1-2-5(8)6(13)11-7-9-3-4-10-12-7/h3-5H,2,8H2,1H3,(H,9,11,12,13)/t5-/m1/s1 |
| InChIKey | AROWWDITQSBJDS-RXMQYKEDSA-N |
| XLogP | -0.45 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |