C7H11N5O2 — CID 67357671
2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid (PubChem CID 67357671) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid.
| Compound Name | 2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid |
|---|---|
| PubChem CID | 67357671 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid |
| SMILES | NC(CCNc1nccnn1)C(=O)O |
| InChI | InChI=1S/C7H11N5O2/c8-5(6(13)14)1-2-9-7-10-3-4-11-12-7/h3-5H,1-2,8H2,(H,13,14)(H,9,10,12) |
| InChIKey | QGIDZWGYHTZKST-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |