C8H11N5OS2 — CID 114912682
1-carbamothioyl-N-(thiatriazol-5-yl)cyclopentane-1-carboxamide (PubChem CID 114912682) has the molecular formula C8H11N5OS2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-carbamothioyl-N-(thiatriazol-5-yl)cyclopentane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(thiatriazol-5-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 114912682 |
| Molecular Formula | C8H11N5OS2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-carbamothioyl-N-(thiatriazol-5-yl)cyclopentane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2nnns2)CCCC1 |
| InChI | InChI=1S/C8H11N5OS2/c9-5(15)8(3-1-2-4-8)6(14)10-7-11-12-13-16-7/h1-4H2,(H2,9,15)(H,10,11,13,14) |
| InChIKey | BYVPYRRKMZZBEX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|