C7H8N4OS2 — CID 114912664
1-carbamothioyl-N-(thiadiazol-5-yl)cyclopropane-1-carboxamide (PubChem CID 114912664) has the molecular formula C7H8N4OS2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 1-carbamothioyl-N-(thiadiazol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(thiadiazol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 114912664 |
| Molecular Formula | C7H8N4OS2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 1-carbamothioyl-N-(thiadiazol-5-yl)cyclopropane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2cnns2)CC1 |
| InChI | InChI=1S/C7H8N4OS2/c8-5(13)7(1-2-7)6(12)10-4-3-9-11-14-4/h3H,1-2H2,(H2,8,13)(H,10,12) |
| InChIKey | AFJSGMMJWCDQGM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|