C7H10N4OS — CID 114912192
1-amino-N-(thiadiazol-5-yl)cyclobutane-1-carboxamide (PubChem CID 114912192) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is 1-amino-N-(thiadiazol-5-yl)cyclobutane-1-carboxamide.
| Compound Name | 1-amino-N-(thiadiazol-5-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 114912192 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1-amino-N-(thiadiazol-5-yl)cyclobutane-1-carboxamide |
| SMILES | NC1(C(=O)Nc2cnns2)CCC1 |
| InChI | InChI=1S/C7H10N4OS/c8-7(2-1-3-7)6(12)10-5-4-9-11-13-5/h4H,1-3,8H2,(H,10,12) |
| InChIKey | GYVZKDWJLXRUIW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |