C8H12N4OS — CID 114912238
1-(aminomethyl)-N-(thiadiazol-5-yl)cyclobutane-1-carboxamide (PubChem CID 114912238) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(thiadiazol-5-yl)cyclobutane-1-carboxamide.
| Compound Name | 1-(aminomethyl)-N-(thiadiazol-5-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 114912238 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-(aminomethyl)-N-(thiadiazol-5-yl)cyclobutane-1-carboxamide |
| SMILES | NCC1(C(=O)Nc2cnns2)CCC1 |
| InChI | InChI=1S/C8H12N4OS/c9-5-8(2-1-3-8)7(13)11-6-4-10-12-14-6/h4H,1-3,5,9H2,(H,11,13) |
| InChIKey | AMZKCRDKYHWBPN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |