C12H13N5O3S — CID 114920770
4-phenyl-2-(thiatriazol-5-ylcarbamoylamino)butanoic acid (PubChem CID 114920770) has the molecular formula C12H13N5O3S and a molecular weight of 307.34 g/mol. Its IUPAC name is 4-phenyl-2-(thiatriazol-5-ylcarbamoylamino)butanoic acid.
| Compound Name | 4-phenyl-2-(thiatriazol-5-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 114920770 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-phenyl-2-(thiatriazol-5-ylcarbamoylamino)butanoic acid |
| SMILES | O=C(Nc1nnns1)NC(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H13N5O3S/c18-10(19)9(7-6-8-4-2-1-3-5-8)13-11(20)14-12-15-16-17-21-12/h1-5,9H,6-7H2,(H,18,19)(H2,13,14,15,17,20) |
| InChIKey | STBVYEZFGLTOKE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |