2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid

C8H10N4O5S — CID 61193061

IUPAC2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid
SMILESO=C(O)CCC(NC(=O)Nc1nncs1)C(=O)O
InChIInChI=1S/C8H10N4O5S/c13-5(14)2-1-4(6(15)16)10-7(17)11-8-12-9-3-18-8/h3-4H,1-2H2,(H,13,14)(H,15,16)(H2,10,11,12,17)
InChIKeyYQNOEIVMTNCNRN-UHFFFAOYSA-N
MW274.26 g/mol
LogP-0.02
Rot. Bonds6

About 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid

2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid (PubChem CID 61193061) has the molecular formula C8H10N4O5S and a molecular weight of 274.26 g/mol. Its IUPAC name is 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid.

Molecular Properties

Compound Name2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid
PubChem CID61193061
Molecular FormulaC8H10N4O5S
Molecular Weight274.26 g/mol
Exact Mass274.04
IUPAC Name2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid
SMILESO=C(O)CCC(NC(=O)Nc1nncs1)C(=O)O
InChIInChI=1S/C8H10N4O5S/c13-5(14)2-1-4(6(15)16)10-7(17)11-8-12-9-3-18-8/h3-4H,1-2H2,(H,13,14)(H,15,16)(H2,10,11,12,17)
InChIKeyYQNOEIVMTNCNRN-UHFFFAOYSA-N
XLogP-0.02
TPSA141.51 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.26
LogP ≤ 5-0.02
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid?
The IUPAC name of 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid (CID 61193061) is 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid.
What is the SMILES notation for 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid?
The canonical SMILES for 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid is O=C(O)CCC(NC(=O)Nc1nncs1)C(=O)O.
What is the InChIKey of 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid?
The InChIKey is YQNOEIVMTNCNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O5S/c13-5(14)2-1-4(6(15)16)10-7(17)11-8-12-9-3-18-8/h3-4H,1-2H2,(H,13,14)(H,15,16)(H2,10,11,12,17).
What are the key properties of 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid?
2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid has a molecular weight of 274.26 g/mol, XLogP of -0.02, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid is sourced from PubChem (CID 61193061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).