C8H10N4O5S — CID 61193061
2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid (PubChem CID 61193061) has the molecular formula C8H10N4O5S and a molecular weight of 274.26 g/mol. Its IUPAC name is 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid.
| Compound Name | 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 61193061 |
| Molecular Formula | C8H10N4O5S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)Nc1nncs1)C(=O)O |
| InChI | InChI=1S/C8H10N4O5S/c13-5(14)2-1-4(6(15)16)10-7(17)11-8-12-9-3-18-8/h3-4H,1-2H2,(H,13,14)(H,15,16)(H2,10,11,12,17) |
| InChIKey | YQNOEIVMTNCNRN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |