C10H14N4O5S — CID 107642531
(2S)-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoylamino]pentanedioic acid (PubChem CID 107642531) has the molecular formula C10H14N4O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is (2S)-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 107642531 |
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (2S)-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoylamino]pentanedioic acid |
| SMILES | CCc1nnc(NC(=O)N[C@@H](CCC(=O)O)C(=O)O)s1 |
| InChI | InChI=1S/C10H14N4O5S/c1-2-6-13-14-10(20-6)12-9(19)11-5(8(17)18)3-4-7(15)16/h5H,2-4H2,1H3,(H,15,16)(H,17,18)(H2,11,12,14,19)/t5-/m0/s1 |
| InChIKey | HLKWRMHHTNOMIY-YFKPBYRVSA-N |
| XLogP | 0.54 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |