C9H15N3O2S — CID 107648177
4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]pentanoic acid (PubChem CID 107648177) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]pentanoic acid.
| Compound Name | 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 107648177 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]pentanoic acid |
| SMILES | CCc1nnc(NC(C)CCC(=O)O)s1 |
| InChI | InChI=1S/C9H15N3O2S/c1-3-7-11-12-9(15-7)10-6(2)4-5-8(13)14/h6H,3-5H2,1-2H3,(H,10,12)(H,13,14) |
| InChIKey | WSBSCTSWNLUZFQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |