C6H9N3O4S2 — CID 107641511
2-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]acetic acid (PubChem CID 107641511) has the molecular formula C6H9N3O4S2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]acetic acid.
| Compound Name | 2-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 107641511 |
| Molecular Formula | C6H9N3O4S2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 2-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]acetic acid |
| SMILES | CCc1nnc(NS(=O)(=O)CC(=O)O)s1 |
| InChI | InChI=1S/C6H9N3O4S2/c1-2-4-7-8-6(14-4)9-15(12,13)3-5(10)11/h2-3H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | NJGIUQVRCHBFRS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |