C9H15N3O4S2 — CID 107641516
methyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]butanoate (PubChem CID 107641516) has the molecular formula C9H15N3O4S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 107641516 |
| Molecular Formula | C9H15N3O4S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | methyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]butanoate |
| SMILES | CCc1nnc(NS(=O)(=O)CCCC(=O)OC)s1 |
| InChI | InChI=1S/C9H15N3O4S2/c1-3-7-10-11-9(17-7)12-18(14,15)6-4-5-8(13)16-2/h3-6H2,1-2H3,(H,11,12) |
| InChIKey | QOLOOKDKLVGSHW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |